pdf string | doi string | doi_sourse string | supplementary int64 | title string | publisher string | year int64 | access int64 | compound_id string | compound_name string | SMILES string | SMILES_type string | metal string | target string | page_smiles int64 | origin_smiles string | page_metal int64 | origin_metal string | page_target_value float64 | origin_target_value string |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
wadas2010 | 10.1021/cr900325h | 10.1002/ejic.200401036 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L1 | null | O=C(O)CN(CC(=O)O)Cc1cc([N+](=O)[O-])ccc1O | ligand | Ga | 19,1 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic980227j | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L2 | null | Sc1ccccc1CN(Cc1ccccc1S)Cc1ccccc1S | ligand | Ga | 20,5 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic951535%2B | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L4 | BAT-TM | CC(C)(S)CNCCNCC(C)(C)S | ligand | Ga | null | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic941330l | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L5 | EC | O=C(O)CC(CS)NCCNC(CS)CC(=O)O | ligand | Ga | 31,5 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1016/S0039-9140(97)00157-4 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L10 | EDTA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 21 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1007/978-1-4615-6764-6 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L10 | EDTA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 22 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1016/0020-1693(94)04012-5 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L11 | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | 37,7 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic00007a024 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L11 | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | 38,5 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1007/978-1-4615-6764-6 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L12 | DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Ga | 25,5 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic951019j | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L15 | SBAD | O=S(=O)([O-])c1ccc(O)c(CCCCNCCNCCNCc2cc(S(=O)(=O)[O-])ccc2O)c1 | ligand | Ga | 28,3 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1016/S1074-5521(00)00111-3 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L16 | BAPEN | Oc1ccccc1C=NCCCNCCNCCCN=Cc1ccccc1O | ligand | Ga | null | 6 | figure 2 | 12 | table 5 (caption) | null | null |
wadas2010 | 10.1021/cr900325h | 10.1080/10610279608032555 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L29 | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 31 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic00067a022 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L29 | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 31 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1080/10610279608032555 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L27 | TACN-TM | SCCN1CCN(CCS)CCN(CCS)CC1 | ligand | Ga | 34,2 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1080/10610279608032555 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L39 | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 21,3 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1080/10610279608032555 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L49 | TETA | O=C(O)CN1CCCN(CC(=O)O)CCN(CC(=O)O)CCCN(CC(=O)O)CC1 | ligand | Ga | 19,7 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1002/ejic.200400075 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L37 | CB-DO2A | O=C(O)CN1CCN2CCN(CC1)CCN(CC(=O)O)CC2 | ligand | Ga | null | 7 | figure 3 | 12 | table 5 (caption) | null | null |
wadas2010 | 10.1021/cr900325h | 10.1021/cr900325h | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L57 | CB-TE2A | O=C(O)CN1CCCN2CCN(CCCN(CC(=O)O)CC2)CC1 | ligand | Ga | null | 7 | figure 3 | 12 | table 5 (caption) | null | null |
wadas2010 | 10.1021/cr900325h | 10.1016/0047-0740(81)90034-6 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L20 | DiP-LICAM | CC(C)N(CCCCN(CCCN(C(=O)c1cccc(O)c1O)C(C)C)C(=O)c1cccc(O)c1O)C(=O)c1cccc(O)c1O | ligand | Ga | 38,6 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/cr900325h | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L66 | null | CC12COCCC(=O)N(O)CCOCC(C)(COCCN(O)C(=O)CCOC1)COCCN(O)C(=O)CCOC2 | ligand | Ga | 27,5 | 7 | figure 3 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic00013a007 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L21 | null | CN(O)C(=O)CCOCC(C)(COCCC(=O)N(C)O)COCCC(=O)N(C)O | ligand | Ga | 25,6 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/cr900325h | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L22 | null | CN(O)C(=O)CCCOCC(C)(COCCCC(=O)N(C)O)COCCCC(=O)N(C)O | ligand | Ga | 27,3 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
wadas2010 | 10.1021/cr900325h | 10.1021/ic00310a035 | 0 | Coordinating Radiometals of Copper, Gallium, Indium, Yttrium, and Zirconium for PET and SPECT Imaging of Disease | American Chemical Society (ACS) | 2,010 | 1 | L23 | DFO | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN | ligand | Ga | 28,6 | 6 | figure 2 | 12 | table 5 (caption) | 12 | table 5 |
kubicek2010 | 10.1021/ic101378s | 10.1021/ic101378s | 0 | Gallium(III) Complexes of DOTA and DOTA−Monoamide: Kinetic and Thermodynamic Studies | American Chemical Society (ACS) | 2,010 | 0 | null | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 26,05 | 2 | chart 1 | 1 | title | 2 | table 2 |
kubicek2010 | 10.1021/ic101378s | 10.1021/ic101378s | 0 | Gallium(III) Complexes of DOTA and DOTA−Monoamide: Kinetic and Thermodynamic Studies | American Chemical Society (ACS) | 2,010 | 0 | null | DO3AMBu | CCCCNC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 24,64 | 2 | chart 1 | 1 | title | 2 | table 2 |
kubicek2010 | 10.1021/ic101378s | 10.1021/ic101378s | 0 | Gallium(III) Complexes of DOTA and DOTA−Monoamide: Kinetic and Thermodynamic Studies | American Chemical Society (ACS) | 2,010 | 0 | null | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 2 | chart 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 26,1 | 2 | figure 1 | 1 | title | 2 | section 1 (text) |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 29,6 | 2 | figure 1 | 1 | title | 2 | section 1 (text) |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NOTAMBP | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NC(P(=O)(O)O)P(=O)(O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NO2APBP | O=C(O)CN1CCN(CC(=O)O)CCN(CP(=O)(O)CC(P(=O)(O)O)P(=O)(O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NO2AP | O=C(O)CN1CCN(CC(=O)O)CCN(CP(=O)(O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NO1A2P | O=C(O)CN1CCN(CP(=O)(O)O)CCN(CP(=O)(O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | DO3APBP | O=C(O)CN1CCN(CC(=O)O)CCN(CP(=O)(O)CC(P(=O)(O)O)P(=O)(O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | DOTAMBP | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)NC(P(=O)(O)O)P(=O)(O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | EDTMP | O=P(O)(O)CN(CCN(CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | MDP | O=P(O)(O)CP(=O)(O)O | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
holub2013 | 10.1002/cmmi.1606 | 10.1002/cmmi.1606 | 0 | Gallium(III) complexes of NOTA‐bis (phosphonate) conjugates as PET radiotracers for bone imaging | Wiley | 2,015 | 0 | null | NOTAGA | O=C(O)CCC(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | HIDA | O=C(O)CN(CCO)CC(=O)O | ligand | Ga | 11,33 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | IDA | O=C(O)CNCC(=O)O | ligand | Ga | 12,76 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | NTA | O=C(O)CN(CC(=O)O)CC(=O)O | ligand | Ga | 16,19 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | UEDDA | NCCN(CC(=O)O)CC(=O)O | ligand | Ga | 16,75 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | HEDTA | O=C(O)CN(CCO)CCN(CC(=O)O)CC(=O)O | ligand | Ga | 17,2 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | TEDTA | O=C(O)CN(CCSCCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 17,3 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | SEDDA | O=C(O)CNCCNCC(=O)O | ligand | Ga | 18,15 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | tiron | O=S(=O)(O)c1cc(O)c(O)c(S(=O)(=O)O)c1 | ligand | Ga | 19,4 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | TMDTA | O=C(O)CN(CCCCCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 20,8 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | EEDTA | O=C(O)CN(CCOCCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 21 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | EDTA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O | ligand | Ga | 21,7 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | CDTA | O=C(O)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O | ligand | Ga | 22,34 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Ga | 23,32 | 2 | figure 1 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | HIBDA | O=C(O)CN(CC(=O)O)Cc1cccc(O)c1 | ligand | Ga | null | 2 | figure 1 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | EHPG | O=C(O)C(NCCNC(C(=O)O)c1ccccc1O)c1ccccc1O | ligand | Ga | 31,61 | 7 | figure 5 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | PLED | Cc1ncc(CO)c(CN(CCN(CC(=O)O)Cc2c(CO)cnc(C)c2O)CC(=O)O)c1O | ligand | Ga | 36,35 | 7 | figure 5 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | 39,57 | 7 | figure 5 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | t-butyl HBED | Cc1cc(C(C)(C)C)cc(CN(CCN(CC(=O)O)Cc2cc(C(C)(C)C)cc(C)c2O)CC(=O)O)c1O | ligand | Ga | null | 7 | figure 5 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | Me4HBED | Cc1cc(C)c(O)c(CN(CCN(CC(=O)O)Cc2cc(C)cc(C)c2O)CC(=O)O)c1 | ligand | Ga | null | 7 | figure 5 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | HBMA | Cc1cc(C)c(O)c(CN(CCO)CCN(CC(=O)O)Cc2cc(C)cc(C)c2O)c1 | ligand | Ga | null | 7 | figure 5 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | SHBED | O=C(O)CN(CCN(CC(=O)O)Cc1cc(S(=O)(=O)[O-])ccc1O)Cc1cc(S(=O)(=O)[O-])ccc1O | ligand | Ga | null | 7 | figure 5 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | DPLED | Cc1cnc(C)c(O)c1CN(CCN(CC(=O)O)Cc1c(C)cnc(C)c1O)CC(=O)O | ligand | Ga | null | 7 | figure 5 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | 3,4-DiP-LICAM | CC(C)N(CCCCN(CCCN(C(=O)c1cccc(O)c1O)C(C)C)C(=O)c1cccc(O)c1O)C(=O)c1cccc(O)c1O | ligand | Ga | 38,6 | 6 | figure 4 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | TiP-MECAMS | CC(C)N(Cc1cc(CN(C(=O)c2cc(S(=O)(=O)O)cc(O)c2O)C(C)C)cc(CN(C(=O)c2cc(S(=O)(=O)O)cc(O)c2O)C(C)C)c1)C(=O)c1cc(S(=O)(=O)O)cc(O)c1O | ligand | Ga | 42 | 6 | figure 4 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | 3,4-DiP-LICAMS | CC(C)N(CCCCN(CCCN(C(=O)c1cc(S(=O)(=O)O)cc(O)c1O)C(C)C)C(=O)c1cc(S(=O)(=O)O)cc(O)c1O)C(=O)c1cc(S(=O)(=O)O)cc(O)c1O | ligand | Ga | 42,1 | 6 | figure 4 | 1 | title | 2 | table 2 |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | desferrioxamine | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(O)N(O)CCCCCN | ligand | Ga | null | 6 | figure 4 | 1 | title | null | null |
green1989 | 10.1016/0883-2897(89)90053-6 | 10.1016/0883-2897(89)90053-6 | 0 | Gallium radiopharmaceutical chemistry | Elsevier BV | 1,989 | 0 | null | enterobactin | O=C(NC1COC(=O)C(NC(=O)c2cccc(O)c2O)COC(=O)C(NC(=O)c2cccc(O)c2O)COC1=O)c1cccc(O)c1O | ligand | Ga | 52 | 6 | figure 4 | 1 | title | 7 | text |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/jm9505977 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DTPA | O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O | ligand | Ga | 24,3 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/ic00310a035 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DFO | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCN | ligand | Ga | 28,6 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/ja106399h | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H2dedpa | O=C(O)c1cccc(CNCCNCc2cccc(C(=O)O)n2)n1 | ligand | Ga | 28,1 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/0020-1693(94)04012-5 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1O | ligand | Ga | 38,5 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1039/C1CC12123E | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H3THP-Ac | CC(=O)NC(CCC(=O)NCc1[nH]c(C)cc(=O)c1O)(CCC(=O)NCc1c(O)c(=O)cc(C)n1C)CCC(=O)NCc1c(O)c(=O)cc(C)n1C | ligand | Ga | null | 3 | table 1 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/S0020-1693(00)80229-7 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 21,3 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/S0020-1693(00)86821-8 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | NOTA | O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CC1 | ligand | Ga | 31 | 3 | table 1 | 1 | title | 3 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/ejic.201201108 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | AAZTA | CC1(N(CC(=O)O)CC(=O)O)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | 22,2 | 4 | table 1 | 1 | title | 4 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/cmdc.201500092 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DATAm | CN(CC(=O)O)C1(C)CN(CC(=O)O)CCN(CC(=O)O)C1 | ligand | Ga | 21,7 | 4 | table 1 | 1 | title | 4 | table 1 |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/bc200319q | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | (NH2)2-sar | NC12CNCCNCC(N)(CNCCNC1)CNCCNC2 | ligand | Ga | null | 4 | table 1 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1002/jlcr.3286 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | Fusarinine C | CC1=CC(=O)N(O)CCCC(N)C(=O)OCCC(C)=CC(=O)N(O)CCCC(N)C(=O)OCCC(C)=CC(=O)N(O)CCCC(N)C(=O)OCC1 | ligand | Ga | null | 4 | table 1 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.apradiso.2011.11.054 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | Porphyrins | C=CC1=C(C)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(C)c5C=C)c(C)c4CCC(=O)O)C(CCC(=O)O)=C3C | ligand | Ga | null | 4 | table 1 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1007/BF00252997 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | CA-DTPA | O=C(O)CN(CCN1CC(=O)OC(=O)C1)CCN1CC(=O)OC(=O)C1 | ligand | Ga | null | 5 | table 2 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.nucmedbio.2012.11.001 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-SCN-DTPA | N#CSc1ccc(CC(CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O)cc1 | ligand | Ga | null | 5 | table 2 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-NH2Bn-DTPA | Nc1ccc(CC(CN(CCN(CC(=O)O)CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O)cc1 | ligand | Ga | null | 5 | table 2 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.3390/ph7050517 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-SCN-Bn-CHX-A-DTPA | N#CSc1ccc(CC(CN(CC(=O)O)C2CCCCC2N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O)cc1 | ligand | Ga | null | 5 | table 2 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1524/ract.2007.95.1.39 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | 1B4M-DTPA | CC(CN(CC(=O)O)CC(Cc1ccc(SC#N)cc1)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | ligand | Ga | null | 5 | table 2 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/0022-1759(87)90492-3 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DFO-Mal | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCN1C(=O)C=CC1=O | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1007/s00259-010-1700-1 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | p-SCN-Bn-DFO | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=S)Nc1ccc(SC#N)cc1 | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1039/B924784J | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | Click DFO | C#CCNC(=S)Nc1ccc(NC(=S)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(=O)CCC(=O)NCCCCCN(O)C(C)=O)cc1 | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.nucmedbio.2009.11.010 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DFO-CHX-Mal | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1 | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DFO-Iac | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CI | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DFO-Bac | CC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CCC(=O)N(O)CCCCCNC(=O)CBr | ligand | Ga | null | 6 | table 3 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.nucmedbio.2012.01.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H2-dp-bb-NCS | N#CSc1ccc(CC(CNCc2cccc(C(=O)O)n2)NCc2cccc(C(=O)O)n2)cc1 | ligand | Ga | null | 7 | table 4 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.nucmedbio.2012.01.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H2-dp-NCS | N#CSc1ccc(CN(CCN(Cc2ccc(SC#N)cc2)Cc2cccc(C(=O)O)n2)Cc2cccc(C(=O)O)n2)cc1 | ligand | Ga | null | 7 | table 4 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/ic302225z | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H2azapa | O=C(O)c1cccc(CN(CCN(Cc2cn(Cc3ccccc3)nn2)Cc2cccc(C(=O)O)n2)Cc2cn(Cc3ccccc3)nn2)n1 | ligand | Ga | null | 7 | table 4 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1016/j.nucmedbio.2010.02.001 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-CC | O=C(O)CCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCC(=O)O)ccc2O)CC(=O)O)c1 | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-CA | NCCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCC(=O)O)ccc2O)CC(=O)O)c1 | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-CI | O=C(O)CCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCN=C=S)ccc2O)CC(=O)O)c1 | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1053/j.semnuclmed.2016.04.003 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-AA | NCCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCN)ccc2O)CC(=O)O)c1 | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.3390/ph7070779 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-CC-TPF | O=C(O)CCc1ccc(O)c(CN(CCN(CC(=O)O)Cc2cc(CCC(=O)Oc3c(F)c(F)cc(F)c3F)ccc2O)CC(=O)O)c1 | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.3390/ph7070779 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | HBED-CC-TPF2 | O=C(O)CN(CCN(CC(=O)O)Cc1cc(CCC(=O)Oc2c(F)c(F)cc(F)c2F)ccc1O)Cc1cc(CCC(=O)Oc2c(F)c(F)cc(F)c2F)ccc1O | ligand | Ga | null | 8 | table 5 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1039/C4DT02978J | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H3THP-Mal | Cc1cc(=O)c(O)c(CNC(=O)CCC(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)NC(=O)CCNC(=O)CCN2C(=O)C=CC2=O)[nH]1 | ligand | Ga | null | 10 | table 6 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/acs.bioconjchem.5b00335 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H3THP-NCS | Cc1cc(=O)c(O)c(CNC(=O)CCC(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)NC(=O)CCSC#N)[nH]1 | ligand | Ga | null | 10 | table 6 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1021/acs.bioconjchem.5b00335 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | H3THP-PhNCS | Cc1cc(=O)c(O)c(CNC(=O)CCC(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)(CCC(=O)NCc2c(O)c(=O)cc(C)n2C)NC(=O)CCNC(=S)Nc2ccc(SC#N)cc2)[nH]1 | ligand | Ga | null | 11 | table 6 | 1 | title | null | null |
spang2016 | 10.1053/j.semnuclmed.2016.04.003 | 10.1007/s00259-008-0757-6 | 0 | Bifunctional Gallium-68 Chelators: Past, Present, and Future | Elsevier BV | 2,016 | 0 | null | DOTA-tris(t-Bu) | CC(C)(C)OC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 | ligand | Ga | null | 11 | table 7 | 1 | title | null | null |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.